C13H20N2O2 — CID 132541981
(2R,7aR)-N,N,2,4-tetramethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide (PubChem CID 132541981) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2R,7aR)-N,N,2,4-tetramethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide.
| Compound Name | (2R,7aR)-N,N,2,4-tetramethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide |
|---|---|
| PubChem CID | 132541981 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (2R,7aR)-N,N,2,4-tetramethyl-5-oxo-3,6,7,7a-tetrahydro-2H-indole-1-carboxamide |
| SMILES | CC1=C2C[C@@H](C)N(C(=O)N(C)C)[C@@H]2CCC1=O |
| InChI | InChI=1S/C13H20N2O2/c1-8-7-10-9(2)12(16)6-5-11(10)15(8)13(17)14(3)4/h8,11H,5-7H2,1-4H3/t8-,11-/m1/s1 |
| InChIKey | NJUMDIDNRIEEOW-LDYMZIIASA-N |
| XLogP | 1.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |