C17H29F3OSi — CID 132542107
tri(propan-2-yl)-[3-[(Z)-5,5,5-trifluoropent-3-enoxy]prop-1-ynyl]silane (PubChem CID 132542107) has the molecular formula C17H29F3OSi and a molecular weight of 334.50 g/mol. Its IUPAC name is tri(propan-2-yl)-[3-[(Z)-5,5,5-trifluoropent-3-enoxy]prop-1-ynyl]silane.
| Compound Name | tri(propan-2-yl)-[3-[(Z)-5,5,5-trifluoropent-3-enoxy]prop-1-ynyl]silane |
|---|---|
| PubChem CID | 132542107 |
| Molecular Formula | C17H29F3OSi |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tri(propan-2-yl)-[3-[(Z)-5,5,5-trifluoropent-3-enoxy]prop-1-ynyl]silane |
| SMILES | CC(C)[Si](C#CCOCC/C=C\C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H29F3OSi/c1-14(2)22(15(3)4,16(5)6)13-9-12-21-11-8-7-10-17(18,19)20/h7,10,14-16H,8,11-12H2,1-6H3/b10-7- |
| InChIKey | QGOKDZMNVULLHR-YFHOEESVSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|