About propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium
propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium (PubChem CID 132542567) has the molecular formula C12H13F3NO+
and a molecular weight of 244.24 g/mol. Its IUPAC name is propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium.
Molecular Properties
| Compound Name | propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium |
| PubChem CID | 132542567 |
| Molecular Formula | C12H13F3NO+ |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium |
| SMILES | CC(C)=[NH+]/C(=C(/O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H12F3NO/c1-8(2)16-10(11(17)12(13,14)15)9-6-4-3-5-7-9/h3-7,17H,1-2H3/p+1/b11-10+ |
| InChIKey | DCJNKLRFLJEMHV-ZHACJKMWSA-O |
| XLogP | 2.04 |
| TPSA | 34.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium?
The IUPAC name of propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium (CID 132542567) is propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium.
What is the SMILES notation for propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium?
The canonical SMILES for propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium is CC(C)=[NH+]/C(=C(/O)C(F)(F)F)c1ccccc1.
What is the InChIKey of propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium?
The InChIKey is DCJNKLRFLJEMHV-ZHACJKMWSA-O. The full InChI is InChI=1S/C12H12F3NO/c1-8(2)16-10(11(17)12(13,14)15)9-6-4-3-5-7-9/h3-7,17H,1-2H3/p+1/b11-10+.
What are the key properties of propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium?
propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium has a molecular weight of 244.24 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylidene-[(E)-3,3,3-trifluoro-2-hydroxy-1-phenylprop-1-enyl]azanium is sourced from PubChem (CID 132542567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).