C29H29NO4 — CID 132543096
methyl (1S,3S,6aR)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1-phenyl-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 132543096) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is methyl (1S,3S,6aR)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1-phenyl-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,6aR)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1-phenyl-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132543096 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | methyl (1S,3S,6aR)-3,4,4-trimethyl-6a-(naphthalene-2-carbonyl)-6-oxo-1-phenyl-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2ccccc2)[C@@]2(C(=O)c3ccc4ccccc4c3)C(=O)CC(C)(C)C21 |
| InChI | InChI=1S/C29H29NO4/c1-27(2)17-22(31)29(24(32)21-15-14-18-10-8-9-13-20(18)16-21)23(19-11-6-5-7-12-19)30-28(3,25(27)29)26(33)34-4/h5-16,23,25,30H,17H2,1-4H3/t23-,25?,28-,29+/m0/s1 |
| InChIKey | NAKMJWBNPVQYEX-LAYJLTFMSA-N |
| XLogP | 4.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|