C37H35NO4 — CID 132543101
methyl (1S,3S,6aR)-3-benzyl-4,4-dimethyl-6-oxo-1-phenyl-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 132543101) has the molecular formula C37H35NO4 and a molecular weight of 557.69 g/mol. Its IUPAC name is methyl (1S,3S,6aR)-3-benzyl-4,4-dimethyl-6-oxo-1-phenyl-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,6aR)-3-benzyl-4,4-dimethyl-6-oxo-1-phenyl-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132543101 |
| Molecular Formula | C37H35NO4 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | methyl (1S,3S,6aR)-3-benzyl-4,4-dimethyl-6-oxo-1-phenyl-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccccc2)N[C@@H](c2ccccc2)[C@@]2(C(=O)c3ccc(-c4ccccc4)cc3)C(=O)CC(C)(C)C21 |
| InChI | InChI=1S/C37H35NO4/c1-35(2)24-30(39)37(32(40)29-21-19-27(20-22-29)26-15-9-5-10-16-26)31(28-17-11-6-12-18-28)38-36(33(35)37,34(41)42-3)23-25-13-7-4-8-14-25/h4-22,31,33,38H,23-24H2,1-3H3/t31-,33?,36-,37+/m0/s1 |
| InChIKey | FHTRBYGGOLBRQS-BQKZEGPBSA-N |
| XLogP | 6.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|