C31H30FNO4 — CID 132543103
methyl (1S,3S,6aR)-1-(3-fluorophenyl)-3,4,4-trimethyl-6-oxo-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 132543103) has the molecular formula C31H30FNO4 and a molecular weight of 499.58 g/mol. Its IUPAC name is methyl (1S,3S,6aR)-1-(3-fluorophenyl)-3,4,4-trimethyl-6-oxo-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3S,6aR)-1-(3-fluorophenyl)-3,4,4-trimethyl-6-oxo-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 132543103 |
| Molecular Formula | C31H30FNO4 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | methyl (1S,3S,6aR)-1-(3-fluorophenyl)-3,4,4-trimethyl-6-oxo-6a-(4-phenylbenzoyl)-1,2,3a,5-tetrahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)N[C@@H](c2cccc(F)c2)[C@@]2(C(=O)c3ccc(-c4ccccc4)cc3)C(=O)CC(C)(C)C21 |
| InChI | InChI=1S/C31H30FNO4/c1-29(2)18-24(34)31(26(35)21-15-13-20(14-16-21)19-9-6-5-7-10-19)25(22-11-8-12-23(32)17-22)33-30(3,27(29)31)28(36)37-4/h5-17,25,27,33H,18H2,1-4H3/t25-,27?,30-,31+/m0/s1 |
| InChIKey | KZHJEANXMUUZML-PWAZOUODSA-N |
| XLogP | 5.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|