About 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid
5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid (PubChem CID 13254315) has the molecular formula C11H20O3S2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid |
| PubChem CID | 13254315 |
| Molecular Formula | C11H20O3S2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid |
| SMILES | CC1(C)SCCC(CCCCC(=O)O)S1=O |
| InChI | InChI=1S/C11H20O3S2/c1-11(2)15-8-7-9(16(11)14)5-3-4-6-10(12)13/h9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | IWUXRIOUNICPCA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid?
The IUPAC name of 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid (CID 13254315) is 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid.
What is the SMILES notation for 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid?
The canonical SMILES for 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid is CC1(C)SCCC(CCCCC(=O)O)S1=O.
What is the InChIKey of 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid?
The InChIKey is IWUXRIOUNICPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3S2/c1-11(2)15-8-7-9(16(11)14)5-3-4-6-10(12)13/h9H,3-8H2,1-2H3,(H,12,13).
What are the key properties of 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid?
5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid has a molecular weight of 264.41 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethyl-3-oxo-1,3-dithian-4-yl)pentanoic acid is sourced from PubChem (CID 13254315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).