C56H40N6O4S2 — CID 132543251
2,3-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile (PubChem CID 132543251) has the molecular formula C56H40N6O4S2 and a molecular weight of 925.11 g/mol. Its IUPAC name is 2,3-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile.
| Compound Name | 2,3-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 132543251 |
| Molecular Formula | C56H40N6O4S2 |
| Molecular Weight | 925.11 g/mol |
| Exact Mass | 924.26 |
| IUPAC Name | 2,3-bis[5-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3ccc(C(=C(C#N)C#N)C(=C(C#N)C#N)c4ccc(-c5ccc(N(c6ccc(OC)cc6)c6ccc(OC)cc6)cc5)s4)s3)cc2)cc1 |
| InChI | InChI=1S/C56H40N6O4S2/c1-63-47-21-13-43(14-22-47)61(44-15-23-48(64-2)24-16-44)41-9-5-37(6-10-41)51-29-31-53(67-51)55(39(33-57)34-58)56(40(35-59)36-60)54-32-30-52(68-54)38-7-11-42(12-8-38)62(45-17-25-49(65-3)26-18-45)46-19-27-50(66-4)28-20-46/h5-32H,1-4H3 |
| InChIKey | ATGKWSNMEXEWMN-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 138.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.11 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|