C42H24N6S2 — CID 132543255
2,3-bis[5-(9-methylcarbazol-2-yl)thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile (PubChem CID 132543255) has the molecular formula C42H24N6S2 and a molecular weight of 676.83 g/mol. Its IUPAC name is 2,3-bis[5-(9-methylcarbazol-2-yl)thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile.
| Compound Name | 2,3-bis[5-(9-methylcarbazol-2-yl)thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
|---|---|
| PubChem CID | 132543255 |
| Molecular Formula | C42H24N6S2 |
| Molecular Weight | 676.83 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | 2,3-bis[5-(9-methylcarbazol-2-yl)thiophen-2-yl]buta-1,3-diene-1,1,4,4-tetracarbonitrile |
| SMILES | Cn1c2ccccc2c2ccc(-c3ccc(C(=C(C#N)C#N)C(=C(C#N)C#N)c4ccc(-c5ccc6c7ccccc7n(C)c6c5)s4)s3)cc21 |
| InChI | InChI=1S/C42H24N6S2/c1-47-33-9-5-3-7-29(33)31-13-11-25(19-35(31)47)37-15-17-39(49-37)41(27(21-43)22-44)42(28(23-45)24-46)40-18-16-38(50-40)26-12-14-32-30-8-4-6-10-34(30)48(2)36(32)20-26/h3-20H,1-2H3 |
| InChIKey | NXFMDIDIEDCQAJ-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.83 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|