About 4-azatricyclo[5.3.1.04,9]undecane
4-azatricyclo[5.3.1.04,9]undecane (PubChem CID 132544181) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 4-azatricyclo[5.3.1.04,9]undecane.
Molecular Properties
| Compound Name | 4-azatricyclo[5.3.1.04,9]undecane |
| PubChem CID | 132544181 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4-azatricyclo[5.3.1.04,9]undecane |
| SMILES | C1CN2CCC3CC1CC2C3 |
| InChI | InChI=1S/C10H17N/c1-3-11-4-2-9-5-8(1)6-10(11)7-9/h8-10H,1-7H2 |
| InChIKey | PXGYQFVAWYDHBX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-azatricyclo[5.3.1.04,9]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azatricyclo[5.3.1.04,9]undecane?
The IUPAC name of 4-azatricyclo[5.3.1.04,9]undecane (CID 132544181) is 4-azatricyclo[5.3.1.04,9]undecane.
What is the SMILES notation for 4-azatricyclo[5.3.1.04,9]undecane?
The canonical SMILES for 4-azatricyclo[5.3.1.04,9]undecane is C1CN2CCC3CC1CC2C3.
What is the InChIKey of 4-azatricyclo[5.3.1.04,9]undecane?
The InChIKey is PXGYQFVAWYDHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-3-11-4-2-9-5-8(1)6-10(11)7-9/h8-10H,1-7H2.
What are the key properties of 4-azatricyclo[5.3.1.04,9]undecane?
4-azatricyclo[5.3.1.04,9]undecane has a molecular weight of 151.25 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azatricyclo[5.3.1.04,9]undecane is sourced from PubChem (CID 132544181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).