C20H19NO2S — CID 132544385
2-(2-methylphenyl)-3-methylsulfonyl-1,2-dihydrobenzo[e]indole (PubChem CID 132544385) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-(2-methylphenyl)-3-methylsulfonyl-1,2-dihydrobenzo[e]indole.
| Compound Name | 2-(2-methylphenyl)-3-methylsulfonyl-1,2-dihydrobenzo[e]indole |
|---|---|
| PubChem CID | 132544385 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(2-methylphenyl)-3-methylsulfonyl-1,2-dihydrobenzo[e]indole |
| SMILES | Cc1ccccc1C1Cc2c(ccc3ccccc23)N1S(C)(=O)=O |
| InChI | InChI=1S/C20H19NO2S/c1-14-7-3-5-9-16(14)20-13-18-17-10-6-4-8-15(17)11-12-19(18)21(20)24(2,22)23/h3-12,20H,13H2,1-2H3 |
| InChIKey | FDQUNJJCQWQQJZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |