About 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one
9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one (PubChem CID 132544704) has the molecular formula C22H15BrO5S
and a molecular weight of 471.33 g/mol. Its IUPAC name is 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one.
Molecular Properties
| Compound Name | 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one |
| PubChem CID | 132544704 |
| Molecular Formula | C22H15BrO5S |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 469.98 |
| IUPAC Name | 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one |
| SMILES | O=C1c2ccccc2C2(O)Oc3ccc(Br)cc3C12CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H15BrO5S/c23-14-10-11-19-18(12-14)21(13-29(26,27)15-6-2-1-3-7-15)20(24)16-8-4-5-9-17(16)22(21,25)28-19/h1-12,25H,13H2 |
| InChIKey | AVFFCUWWXJAETE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one?
The IUPAC name of 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one (CID 132544704) is 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one.
What is the SMILES notation for 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one?
The canonical SMILES for 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one is O=C1c2ccccc2C2(O)Oc3ccc(Br)cc3C12CS(=O)(=O)c1ccccc1.
What is the InChIKey of 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one?
The InChIKey is AVFFCUWWXJAETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrO5S/c23-14-10-11-19-18(12-14)21(13-29(26,27)15-6-2-1-3-7-15)20(24)16-8-4-5-9-17(16)22(21,25)28-19/h1-12,25H,13H2.
What are the key properties of 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one?
9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one has a molecular weight of 471.33 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9b-(benzenesulfonylmethyl)-8-bromo-4b-hydroxyindeno[1,2-b][1]benzofuran-10-one is sourced from PubChem (CID 132544704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).