About 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one
4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 132545090) has the molecular formula C24H16BrN3O
and a molecular weight of 442.32 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| PubChem CID | 132545090 |
| Molecular Formula | C24H16BrN3O |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | O=c1c2c(-c3ccc(Br)cc3)cc(-c3ccccc3)nc2[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C24H16BrN3O/c25-18-13-11-16(12-14-18)20-15-21(17-7-3-1-4-8-17)26-23-22(20)24(29)28(27-23)19-9-5-2-6-10-19/h1-15H,(H,26,27) |
| InChIKey | VCYZSMFJUPPJKZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
The IUPAC name of 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one (CID 132545090) is 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one.
What is the SMILES notation for 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
The canonical SMILES for 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one is O=c1c2c(-c3ccc(Br)cc3)cc(-c3ccccc3)nc2[nH]n1-c1ccccc1.
What is the InChIKey of 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
The InChIKey is VCYZSMFJUPPJKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16BrN3O/c25-18-13-11-16(12-14-18)20-15-21(17-7-3-1-4-8-17)26-23-22(20)24(29)28(27-23)19-9-5-2-6-10-19/h1-15H,(H,26,27).
What are the key properties of 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one?
4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one has a molecular weight of 442.32 g/mol, XLogP of 5.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2,6-diphenyl-1H-pyrazolo[3,4-b]pyridin-3-one is sourced from PubChem (CID 132545090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).