C14H18O3 — CID 132545348
(9R)-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one (PubChem CID 132545348) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (9R)-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one.
| Compound Name | (9R)-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one |
|---|---|
| PubChem CID | 132545348 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (9R)-2,3,5,9-tetramethyl-11,12-dioxatricyclo[7.2.1.01,6]dodeca-2,5-dien-4-one |
| SMILES | CC1=C(C)C23OC[C@@](C)(CCC2=C(C)C1=O)O3 |
| InChI | InChI=1S/C14H18O3/c1-8-10(3)14-11(9(2)12(8)15)5-6-13(4,17-14)7-16-14/h5-7H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | RCPZPIDNISPTJW-KWCCSABGSA-N |
| XLogP | 2.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |