C28H28S18 — CID 132545462
2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-4,5-bis[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiole (PubChem CID 132545462) has the molecular formula C28H28S18 and a molecular weight of 941.74 g/mol. Its IUPAC name is 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-4,5-bis[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiole.
| Compound Name | 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-4,5-bis[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiole |
|---|---|
| PubChem CID | 132545462 |
| Molecular Formula | C28H28S18 |
| Molecular Weight | 941.74 g/mol |
| Exact Mass | 939.72 |
| IUPAC Name | 2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-4,5-bis[[2-(4,5-dimethyl-1,3-dithiol-2-ylidene)-5-methylsulfanyl-1,3-dithiol-4-yl]sulfanylmethylsulfanyl]-1,3-dithiole |
| SMILES | CSC1=C(SCSC2=C(SCSC3=C(SC)SC(=C4SC(C)=C(C)S4)S3)SC(=C3SC(C)=C(C)S3)S2)SC(=C2SC(C)=C(C)S2)S1 |
| InChI | InChI=1S/C28H28S18/c1-11-12(2)36-23(35-11)26-41-17(29-7)19(43-26)31-9-33-21-22(46-28(45-21)25-39-15(5)16(6)40-25)34-10-32-20-18(30-8)42-27(44-20)24-37-13(3)14(4)38-24/h9-10H2,1-8H3 |
| InChIKey | YNHCVYSRMJUNAJ-UHFFFAOYSA-N |
| XLogP | 17.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.74 |
| LogP ≤ 5 | 17.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|