About (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene
(4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene (PubChem CID 132545718) has the molecular formula C16H14BrF3N2
and a molecular weight of 371.20 g/mol. Its IUPAC name is (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene.
Molecular Properties
| Compound Name | (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene |
| PubChem CID | 132545718 |
| Molecular Formula | C16H14BrF3N2 |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene |
| SMILES | FC(F)(F)CC(Cc1ccccc1)/N=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrF3N2/c17-13-6-8-14(9-7-13)21-22-15(11-16(18,19)20)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2/b22-21+ |
| InChIKey | WFUYPXDLKZVVIY-QURGRASLSA-N |
| XLogP | 6.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene?
The IUPAC name of (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene (CID 132545718) is (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene.
What is the SMILES notation for (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene?
The canonical SMILES for (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene is FC(F)(F)CC(Cc1ccccc1)/N=N/c1ccc(Br)cc1.
What is the InChIKey of (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene?
The InChIKey is WFUYPXDLKZVVIY-QURGRASLSA-N. The full InChI is InChI=1S/C16H14BrF3N2/c17-13-6-8-14(9-7-13)21-22-15(11-16(18,19)20)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2/b22-21+.
What are the key properties of (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene?
(4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene has a molecular weight of 371.20 g/mol, XLogP of 6.10, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene is sourced from PubChem (CID 132545718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).