C27H54N5O7+ — CID 132545798
[2-hydroxy-3-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]propyl]-dimethyl-octylazanium (PubChem CID 132545798) has the molecular formula C27H54N5O7+ and a molecular weight of 560.76 g/mol. Its IUPAC name is [2-hydroxy-3-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]propyl]-dimethyl-octylazanium.
| Compound Name | [2-hydroxy-3-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]propyl]-dimethyl-octylazanium |
|---|---|
| PubChem CID | 132545798 |
| Molecular Formula | C27H54N5O7+ |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.40 |
| IUPAC Name | [2-hydroxy-3-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]propyl]-dimethyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(C)CC(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C27H53N5O7/c1-4-5-6-7-8-9-18-32(2,3)23-24(33)19-28-10-12-29(20-25(34)35)14-16-31(22-27(38)39)17-15-30(13-11-28)21-26(36)37/h24,33H,4-23H2,1-3H3,(H2-,34,35,36,37,38,39)/p+1 |
| InChIKey | ZCOBXIBAPMQKCP-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 145.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|