About ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate
ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate (PubChem CID 132545963) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
| PubChem CID | 132545963 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate |
| SMILES | CCOC(=O)c1c2n(c3ccccc13)CC(O)C2 |
| InChI | InChI=1S/C14H15NO3/c1-2-18-14(17)13-10-5-3-4-6-11(10)15-8-9(16)7-12(13)15/h3-6,9,16H,2,7-8H2,1H3 |
| InChIKey | LGHLTZYBJFDSIH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
The IUPAC name of ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate (CID 132545963) is ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate.
What is the SMILES notation for ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
The canonical SMILES for ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate is CCOC(=O)c1c2n(c3ccccc13)CC(O)C2.
What is the InChIKey of ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
The InChIKey is LGHLTZYBJFDSIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-2-18-14(17)13-10-5-3-4-6-11(10)15-8-9(16)7-12(13)15/h3-6,9,16H,2,7-8H2,1H3.
What are the key properties of ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate?
ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate has a molecular weight of 245.28 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-2,3-dihydro-1H-pyrrolo[1,2-a]indole-4-carboxylate is sourced from PubChem (CID 132545963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).