C18H16N4O2 — CID 132547191
5-amino-3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carbonitrile (PubChem CID 132547191) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 5-amino-3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 132547191 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 5-amino-3-(3,4-dimethoxyphenyl)-1-phenylpyrazole-4-carbonitrile |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)c(N)c2C#N)cc1OC |
| InChI | InChI=1S/C18H16N4O2/c1-23-15-9-8-12(10-16(15)24-2)17-14(11-19)18(20)22(21-17)13-6-4-3-5-7-13/h3-10H,20H2,1-2H3 |
| InChIKey | IEPQQKPQQMZUHA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |