C26H33NO11 — CID 132547256
[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-oxo-6-phenylhexanoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 132547256) has the molecular formula C26H33NO11 and a molecular weight of 535.55 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-oxo-6-phenylhexanoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-oxo-6-phenylhexanoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132547256 |
| Molecular Formula | C26H33NO11 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-[(3-oxo-6-phenylhexanoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)CC(=O)CCCc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H33NO11/c1-15(28)34-14-21-24(35-16(2)29)25(36-17(3)30)23(26(38-21)37-18(4)31)27-22(33)13-20(32)12-8-11-19-9-6-5-7-10-19/h5-7,9-10,21,23-26H,8,11-14H2,1-4H3,(H,27,33)/t21-,23-,24-,25-,26-/m1/s1 |
| InChIKey | IETUBJMHKBNRPR-SMHDKVMMSA-N |
| XLogP | 1.17 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|