C21H36O2 — CID 13254726
[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hexanoate (PubChem CID 13254726) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hexanoate.
| Compound Name | [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hexanoate |
|---|---|
| PubChem CID | 13254726 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] hexanoate |
| SMILES | CCCCCC(=O)OC/C=C(/C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H36O2/c1-6-7-8-15-21(22)23-17-16-20(5)14-10-13-19(4)12-9-11-18(2)3/h11,13,16H,6-10,12,14-15,17H2,1-5H3/b19-13+,20-16- |
| InChIKey | RLRVQTPROCYANT-QBAIPTAWSA-N |
| XLogP | 6.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|