C24H29ClN4O — CID 132547277
3-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]-2-methylquinazolin-4-one (PubChem CID 132547277) has the molecular formula C24H29ClN4O and a molecular weight of 424.98 g/mol. Its IUPAC name is 3-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]-2-methylquinazolin-4-one.
| Compound Name | 3-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 132547277 |
| Molecular Formula | C24H29ClN4O |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-[5-[4-(3-chlorophenyl)piperazin-1-yl]pentyl]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1CCCCCN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H29ClN4O/c1-19-26-23-11-4-3-10-22(23)24(30)29(19)13-6-2-5-12-27-14-16-28(17-15-27)21-9-7-8-20(25)18-21/h3-4,7-11,18H,2,5-6,12-17H2,1H3 |
| InChIKey | IUHLOLZVDWRWFT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|