C23H22O13 — CID 132547650
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxyoxan-2-yl]methyl hydrogen carbonate (PubChem CID 132547650) has the molecular formula C23H22O13 and a molecular weight of 506.42 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxyoxan-2-yl]methyl hydrogen carbonate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxyoxan-2-yl]methyl hydrogen carbonate |
|---|---|
| PubChem CID | 132547650 |
| Molecular Formula | C23H22O13 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxochromen-3-yl]oxyoxan-2-yl]methyl hydrogen carbonate |
| SMILES | COc1cc(O)c2c(=O)c(O[C@@H]3O[C@H](COC(=O)O)[C@@H](O)[C@H](O)[C@H]3O)c(-c3ccc(O)cc3)oc2c1 |
| InChI | InChI=1S/C23H22O13/c1-32-11-6-12(25)15-13(7-11)34-20(9-2-4-10(24)5-3-9)21(17(15)27)36-22-19(29)18(28)16(26)14(35-22)8-33-23(30)31/h2-7,14,16,18-19,22,24-26,28-29H,8H2,1H3,(H,30,31)/t14-,16-,18+,19-,22+/m1/s1 |
| InChIKey | CGJYBQUEMYZEEM-LFXZADKFSA-N |
| XLogP | 0.76 |
| TPSA | 205.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |