C10H14N2 — CID 132548187
(7R)-7-methyl-5,6,7,8-tetrahydroisoquinolin-3-amine (PubChem CID 132548187) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (7R)-7-methyl-5,6,7,8-tetrahydroisoquinolin-3-amine.
| Compound Name | (7R)-7-methyl-5,6,7,8-tetrahydroisoquinolin-3-amine |
|---|---|
| PubChem CID | 132548187 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (7R)-7-methyl-5,6,7,8-tetrahydroisoquinolin-3-amine |
| SMILES | C[C@@H]1CCc2cc(N)ncc2C1 |
| InChI | InChI=1S/C10H14N2/c1-7-2-3-8-5-10(11)12-6-9(8)4-7/h5-7H,2-4H2,1H3,(H2,11,12)/t7-/m1/s1 |
| InChIKey | KTKITMBZKOQHGH-SSDOTTSWSA-N |
| XLogP | 1.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |