C18H24N2O3 — CID 132548302
(2E)-2-(3-benzyl-4,4-dimethyl-2-oxo-1,3-oxazolidin-5-ylidene)-N,N-diethylacetamide (PubChem CID 132548302) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2E)-2-(3-benzyl-4,4-dimethyl-2-oxo-1,3-oxazolidin-5-ylidene)-N,N-diethylacetamide.
| Compound Name | (2E)-2-(3-benzyl-4,4-dimethyl-2-oxo-1,3-oxazolidin-5-ylidene)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 132548302 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (2E)-2-(3-benzyl-4,4-dimethyl-2-oxo-1,3-oxazolidin-5-ylidene)-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)/C=C1/OC(=O)N(Cc2ccccc2)C1(C)C |
| InChI | InChI=1S/C18H24N2O3/c1-5-19(6-2)16(21)12-15-18(3,4)20(17(22)23-15)13-14-10-8-7-9-11-14/h7-12H,5-6,13H2,1-4H3/b15-12+ |
| InChIKey | CMCDDCKNXOVEJR-NTCAYCPXSA-N |
| XLogP | 3.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|