C22H21ClN2O2Se — CID 132548350
N-[5-(4-chlorophenyl)selanyl-6-methoxyquinolin-8-yl]cyclopentanecarboxamide (PubChem CID 132548350) has the molecular formula C22H21ClN2O2Se and a molecular weight of 459.84 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)selanyl-6-methoxyquinolin-8-yl]cyclopentanecarboxamide.
| Compound Name | N-[5-(4-chlorophenyl)selanyl-6-methoxyquinolin-8-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 132548350 |
| Molecular Formula | C22H21ClN2O2Se |
| Molecular Weight | 459.84 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-[5-(4-chlorophenyl)selanyl-6-methoxyquinolin-8-yl]cyclopentanecarboxamide |
| SMILES | COc1cc(NC(=O)C2CCCC2)c2ncccc2c1[Se]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN2O2Se/c1-27-19-13-18(25-22(26)14-5-2-3-6-14)20-17(7-4-12-24-20)21(19)28-16-10-8-15(23)9-11-16/h4,7-14H,2-3,5-6H2,1H3,(H,25,26) |
| InChIKey | AKGMHKZLQFZXNB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|