C23H36O9 — CID 132548425
(2,6-ditert-butyl-4-methoxyphenyl) (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 132548425) has the molecular formula C23H36O9 and a molecular weight of 456.53 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methoxyphenyl) (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methoxyphenyl) (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 132548425 |
| Molecular Formula | C23H36O9 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | (2,6-ditert-butyl-4-methoxyphenyl) (2R,4R,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COc1cc(C(C)(C)C)c(OC(=O)[C@@]2(O)C[C@@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H36O9/c1-21(2,3)13-8-12(30-7)9-14(22(4,5)6)18(13)31-20(28)23(29)10-15(25)17(27)19(32-23)16(26)11-24/h8-9,15-17,19,24-27,29H,10-11H2,1-7H3/t15-,16-,17-,19-,23-/m1/s1 |
| InChIKey | BTSGYELSKKATFR-HMFTUFPWSA-N |
| XLogP | 0.75 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|