C32H34N2O2P+ — CID 132548961
3-hydroxy-16-(2-methylphenyl)-23-aza-9-azonia-3λ5-phosphaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene 3-oxide (PubChem CID 132548961) has the molecular formula C32H34N2O2P+ and a molecular weight of 509.61 g/mol. Its IUPAC name is 3-hydroxy-16-(2-methylphenyl)-23-aza-9-azonia-3λ5-phosphaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene 3-oxide.
| Compound Name | 3-hydroxy-16-(2-methylphenyl)-23-aza-9-azonia-3λ5-phosphaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene 3-oxide |
|---|---|
| PubChem CID | 132548961 |
| Molecular Formula | C32H34N2O2P+ |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 3-hydroxy-16-(2-methylphenyl)-23-aza-9-azonia-3λ5-phosphaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaene 3-oxide |
| SMILES | Cc1ccccc1C1=c2cc3c4c(c2P(=O)(O)c2c1cc1c5c2CCCN5CCC1)CCC[N+]=4CCC3 |
| InChI | InChI=1S/C32H33N2O2P/c1-20-8-2-3-11-23(20)28-26-18-21-9-4-14-33-16-6-12-24(29(21)33)31(26)37(35,36)32-25-13-7-17-34-15-5-10-22(30(25)34)19-27(28)32/h2-3,8,11,18-19H,4-7,9-10,12-17H2,1H3/p+1 |
| InChIKey | QIVVDHPUPGKQIC-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|