C31H38F18N2O7Si — CID 132548969
[2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(3-trimethoxysilylpropyl)carbamate (PubChem CID 132548969) has the molecular formula C31H38F18N2O7Si and a molecular weight of 920.70 g/mol. Its IUPAC name is [2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(3-trimethoxysilylpropyl)carbamate.
| Compound Name | [2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(3-trimethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 132548969 |
| Molecular Formula | C31H38F18N2O7Si |
| Molecular Weight | 920.70 g/mol |
| Exact Mass | 920.22 |
| IUPAC Name | [2-methyl-1-[2-nitro-4,5-bis(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)phenyl]propyl] N-(3-trimethoxysilylpropyl)carbamate |
| SMILES | CO[Si](CCCNC(=O)OC(c1cc(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1[N+](=O)[O-])C(C)C)(OC)OC |
| InChI | InChI=1S/C31H38F18N2O7Si/c1-17(2)22(58-23(52)50-13-8-14-59(55-3,56-4)57-5)20-15-18(9-6-11-24(32,33)26(36,37)28(40,41)30(44,45)46)19(16-21(20)51(53)54)10-7-12-25(34,35)27(38,39)29(42,43)31(47,48)49/h15-17,22H,6-14H2,1-5H3,(H,50,52) |
| InChIKey | VMMNYYWPIIKICH-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.70 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|