C20H18ClNO3 — CID 132549318
5-[2-(2-chlorophenyl)ethynyl]-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 132549318) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)ethynyl]-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 5-[2-(2-chlorophenyl)ethynyl]-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 132549318 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 5-[2-(2-chlorophenyl)ethynyl]-4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | COc1c2c(cc3c1C(C#Cc1ccccc1Cl)N(C)CC3)OCO2 |
| InChI | InChI=1S/C20H18ClNO3/c1-22-10-9-14-11-17-19(25-12-24-17)20(23-2)18(14)16(22)8-7-13-5-3-4-6-15(13)21/h3-6,11,16H,9-10,12H2,1-2H3 |
| InChIKey | YWBAYEVEBQPFEU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|