C17H10Cl2N2O3 — CID 132549651
(2S,3S)-3-(3,4-dichlorophenyl)-2-nitro-5-phenyl-2,3-dihydrofuran-4-carbonitrile (PubChem CID 132549651) has the molecular formula C17H10Cl2N2O3 and a molecular weight of 361.18 g/mol. Its IUPAC name is (2S,3S)-3-(3,4-dichlorophenyl)-2-nitro-5-phenyl-2,3-dihydrofuran-4-carbonitrile.
| Compound Name | (2S,3S)-3-(3,4-dichlorophenyl)-2-nitro-5-phenyl-2,3-dihydrofuran-4-carbonitrile |
|---|---|
| PubChem CID | 132549651 |
| Molecular Formula | C17H10Cl2N2O3 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (2S,3S)-3-(3,4-dichlorophenyl)-2-nitro-5-phenyl-2,3-dihydrofuran-4-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2)O[C@H]([N+](=O)[O-])[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl2N2O3/c18-13-7-6-11(8-14(13)19)15-12(9-20)16(24-17(15)21(22)23)10-4-2-1-3-5-10/h1-8,15,17H/t15-,17-/m0/s1 |
| InChIKey | RYIAVOKYGWVLJH-RDJZCZTQSA-N |
| XLogP | 4.64 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|