C19H41BO3Si — CID 132550023
tri(propan-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane (PubChem CID 132550023) has the molecular formula C19H41BO3Si and a molecular weight of 356.43 g/mol. Its IUPAC name is tri(propan-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane.
| Compound Name | tri(propan-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane |
|---|---|
| PubChem CID | 132550023 |
| Molecular Formula | C19H41BO3Si |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | tri(propan-2-yl)-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butoxy]silane |
| SMILES | CC(C)[Si](OCCCCB1OC(C)(C)C(C)(C)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H41BO3Si/c1-15(2)24(16(3)4,17(5)6)21-14-12-11-13-20-22-18(7,8)19(9,10)23-20/h15-17H,11-14H2,1-10H3 |
| InChIKey | QRJHJACJGBDOJP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|