About 4,5,5-triethoxypentan-2-one
4,5,5-triethoxypentan-2-one (PubChem CID 132550050) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 4,5,5-triethoxypentan-2-one.
Molecular Properties
| Compound Name | 4,5,5-triethoxypentan-2-one |
| PubChem CID | 132550050 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4,5,5-triethoxypentan-2-one |
| SMILES | CCOC(CC(C)=O)C(OCC)OCC |
| InChI | InChI=1S/C11H22O4/c1-5-13-10(8-9(4)12)11(14-6-2)15-7-3/h10-11H,5-8H2,1-4H3 |
| InChIKey | BXFGPYPJIXHZQJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,5,5-triethoxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,5-triethoxypentan-2-one?
The IUPAC name of 4,5,5-triethoxypentan-2-one (CID 132550050) is 4,5,5-triethoxypentan-2-one.
What is the SMILES notation for 4,5,5-triethoxypentan-2-one?
The canonical SMILES for 4,5,5-triethoxypentan-2-one is CCOC(CC(C)=O)C(OCC)OCC.
What is the InChIKey of 4,5,5-triethoxypentan-2-one?
The InChIKey is BXFGPYPJIXHZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-5-13-10(8-9(4)12)11(14-6-2)15-7-3/h10-11H,5-8H2,1-4H3.
What are the key properties of 4,5,5-triethoxypentan-2-one?
4,5,5-triethoxypentan-2-one has a molecular weight of 218.29 g/mol, XLogP of 1.77, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,5-triethoxypentan-2-one is sourced from PubChem (CID 132550050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).