C11H17NO4 — CID 13255010
(4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid (PubChem CID 13255010) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 13255010 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylic acid |
| SMILES | C/C=C/C[C@@H](C)[C@H]1OC(=O)N(C)[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H17NO4/c1-4-5-6-7(2)9-8(10(13)14)12(3)11(15)16-9/h4-5,7-9H,6H2,1-3H3,(H,13,14)/b5-4+/t7-,8+,9-/m1/s1 |
| InChIKey | BGAUKFKTGVDRHY-UNISNWAASA-N |
| XLogP | 1.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|