C13H10Br2F3N3O3 — CID 132550169
(3S,3'S,4'R)-5,7-dibromo-1'-methyl-3'-nitro-4'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 132550169) has the molecular formula C13H10Br2F3N3O3 and a molecular weight of 473.04 g/mol. Its IUPAC name is (3S,3'S,4'R)-5,7-dibromo-1'-methyl-3'-nitro-4'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
| Compound Name | (3S,3'S,4'R)-5,7-dibromo-1'-methyl-3'-nitro-4'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 132550169 |
| Molecular Formula | C13H10Br2F3N3O3 |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 470.90 |
| IUPAC Name | (3S,3'S,4'R)-5,7-dibromo-1'-methyl-3'-nitro-4'-(trifluoromethyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | CN1C[C@@H](C(F)(F)F)[C@H]([N+](=O)[O-])[C@@]12C(=O)Nc1c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C13H10Br2F3N3O3/c1-20-4-7(13(16,17)18)10(21(23)24)12(20)6-2-5(14)3-8(15)9(6)19-11(12)22/h2-3,7,10H,4H2,1H3,(H,19,22)/t7-,10+,12+/m1/s1 |
| InChIKey | GQVQQMYPCDDRNW-VHRDEZTHSA-N |
| XLogP | 3.13 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|