C10H19NO3 — CID 13255022
(Z,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid (PubChem CID 13255022) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (Z,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid.
| Compound Name | (Z,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid |
|---|---|
| PubChem CID | 13255022 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (Z,2S,3R,4R)-3-hydroxy-4-methyl-2-(methylamino)oct-6-enoic acid |
| SMILES | C/C=C\C[C@@H](C)[C@@H](O)[C@H](NC)C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-4-5-6-7(2)9(12)8(11-3)10(13)14/h4-5,7-9,11-12H,6H2,1-3H3,(H,13,14)/b5-4-/t7-,8+,9-/m1/s1 |
| InChIKey | AHQFCPOIMVMDEZ-HDVQFBALSA-N |
| XLogP | 0.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|