C20H22O8 — CID 132550392
4-hydroxy-5-(3-hydroxybutyl)-3-[3-hydroxy-2-(3-hydroxybutyl)-5,6-dioxocyclohexa-1,3-dien-1-yl]cyclohexa-3,5-diene-1,2-dione (PubChem CID 132550392) has the molecular formula C20H22O8 and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-hydroxy-5-(3-hydroxybutyl)-3-[3-hydroxy-2-(3-hydroxybutyl)-5,6-dioxocyclohexa-1,3-dien-1-yl]cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-hydroxy-5-(3-hydroxybutyl)-3-[3-hydroxy-2-(3-hydroxybutyl)-5,6-dioxocyclohexa-1,3-dien-1-yl]cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 132550392 |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-hydroxy-5-(3-hydroxybutyl)-3-[3-hydroxy-2-(3-hydroxybutyl)-5,6-dioxocyclohexa-1,3-dien-1-yl]cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(O)CCC1=CC(=O)C(=O)C(C2=C(CCC(C)O)C(O)=CC(=O)C2=O)=C1O |
| InChI | InChI=1S/C20H22O8/c1-9(21)3-5-11-7-14(24)20(28)17(18(11)26)16-12(6-4-10(2)22)13(23)8-15(25)19(16)27/h7-10,21-23,26H,3-6H2,1-2H3 |
| InChIKey | YHNXNFUIRJSQAB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|