C25H23F6NO2S2 — CID 132550686
2-[3,5-bis(trifluoromethyl)phenyl]-4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)pyridine (PubChem CID 132550686) has the molecular formula C25H23F6NO2S2 and a molecular weight of 547.59 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)pyridine.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)pyridine |
|---|---|
| PubChem CID | 132550686 |
| Molecular Formula | C25H23F6NO2S2 |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)pyridine |
| SMILES | CCCCCCSc1sc(-c2ccnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)c2c1OCCO2 |
| InChI | InChI=1S/C25H23F6NO2S2/c1-2-3-4-5-10-35-23-21-20(33-8-9-34-21)22(36-23)15-6-7-32-19(13-15)16-11-17(24(26,27)28)14-18(12-16)25(29,30)31/h6-7,11-14H,2-5,8-10H2,1H3 |
| InChIKey | NQOWNTRVWMKOKB-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|