C22H10N6O — CID 132550924
5-amino-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-3,3,4-tricarbonitrile (PubChem CID 132550924) has the molecular formula C22H10N6O and a molecular weight of 374.36 g/mol. Its IUPAC name is 5-amino-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-3,3,4-tricarbonitrile.
| Compound Name | 5-amino-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-3,3,4-tricarbonitrile |
|---|---|
| PubChem CID | 132550924 |
| Molecular Formula | C22H10N6O |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-amino-6-oxa-15,22-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(22),2(7),4,8,10,12,14,16,18,20-decaene-3,3,4-tricarbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c3nc4ccccc4nc3c3ccccc23)C1(C#N)C#N |
| InChI | InChI=1S/C22H10N6O/c23-9-14-21(26)29-20-13-6-2-1-5-12(13)18-19(17(20)22(14,10-24)11-25)28-16-8-4-3-7-15(16)27-18/h1-8H,26H2 |
| InChIKey | BCOFPMRQBXLFNL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|