C20H22S2 — CID 132551010
3-hexyl-5-phenyl-2-thiophen-2-ylthiophene (PubChem CID 132551010) has the molecular formula C20H22S2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 3-hexyl-5-phenyl-2-thiophen-2-ylthiophene.
| Compound Name | 3-hexyl-5-phenyl-2-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 132551010 |
| Molecular Formula | C20H22S2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-hexyl-5-phenyl-2-thiophen-2-ylthiophene |
| SMILES | CCCCCCc1cc(-c2ccccc2)sc1-c1cccs1 |
| InChI | InChI=1S/C20H22S2/c1-2-3-4-6-12-17-15-19(16-10-7-5-8-11-16)22-20(17)18-13-9-14-21-18/h5,7-11,13-15H,2-4,6,12H2,1H3 |
| InChIKey | JOTDNCLUSMFKCA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|