About [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate
[(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate (PubChem CID 132551412) has the molecular formula C21H40O6
and a molecular weight of 388.55 g/mol. Its IUPAC name is [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate.
Molecular Properties
| Compound Name | [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate |
| PubChem CID | 132551412 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate |
| SMILES | CCCCC[C@@H](O)C[C@@H](O)CC(=O)O[C@H](CCCCC)CCCC(=O)OC |
| InChI | InChI=1S/C21H40O6/c1-4-6-8-11-17(22)15-18(23)16-21(25)27-19(12-9-7-5-2)13-10-14-20(24)26-3/h17-19,22-23H,4-16H2,1-3H3/t17-,18-,19-/m1/s1 |
| InChIKey | NZRUDJPSBIXCFY-GUDVDZBRSA-N |
| XLogP | 3.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate?
The IUPAC name of [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate (CID 132551412) is [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate.
What is the SMILES notation for [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate?
The canonical SMILES for [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate is CCCCC[C@@H](O)C[C@@H](O)CC(=O)O[C@H](CCCCC)CCCC(=O)OC.
What is the InChIKey of [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate?
The InChIKey is NZRUDJPSBIXCFY-GUDVDZBRSA-N. The full InChI is InChI=1S/C21H40O6/c1-4-6-8-11-17(22)15-18(23)16-21(25)27-19(12-9-7-5-2)13-10-14-20(24)26-3/h17-19,22-23H,4-16H2,1-3H3/t17-,18-,19-/m1/s1.
What are the key properties of [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate?
[(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate has a molecular weight of 388.55 g/mol, XLogP of 3.90, 17 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-1-methoxy-1-oxodecan-5-yl] (3R,5R)-3,5-dihydroxydecanoate is sourced from PubChem (CID 132551412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).