C16H18N2O3 — CID 132551642
methyl (2Z)-2-[(6aS)-12-oxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-6-ylidene]acetate (PubChem CID 132551642) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is methyl (2Z)-2-[(6aS)-12-oxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-6-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(6aS)-12-oxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-6-ylidene]acetate |
|---|---|
| PubChem CID | 132551642 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | methyl (2Z)-2-[(6aS)-12-oxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-6-ylidene]acetate |
| SMILES | COC(=O)/C=C1\Nc2ccccc2C(=O)N2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H18N2O3/c1-21-15(19)10-13-14-8-4-5-9-18(14)16(20)11-6-2-3-7-12(11)17-13/h2-3,6-7,10,14,17H,4-5,8-9H2,1H3/b13-10-/t14-/m0/s1 |
| InChIKey | SYIHXAHHOQFPSO-ZVHGMHCTSA-N |
| XLogP | 2.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|