C52H60N6O8 — CID 132551991
diethyl 2,5-bis[4-[2-(3-octyl-2,6-dioxopyrimidin-4-yl)ethynyl]anilino]benzene-1,4-dicarboxylate (PubChem CID 132551991) has the molecular formula C52H60N6O8 and a molecular weight of 897.09 g/mol. Its IUPAC name is diethyl 2,5-bis[4-[2-(3-octyl-2,6-dioxopyrimidin-4-yl)ethynyl]anilino]benzene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-bis[4-[2-(3-octyl-2,6-dioxopyrimidin-4-yl)ethynyl]anilino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 132551991 |
| Molecular Formula | C52H60N6O8 |
| Molecular Weight | 897.09 g/mol |
| Exact Mass | 896.45 |
| IUPAC Name | diethyl 2,5-bis[4-[2-(3-octyl-2,6-dioxopyrimidin-4-yl)ethynyl]anilino]benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCn1c(C#Cc2ccc(Nc3cc(C(=O)OCC)c(Nc4ccc(C#Cc5cc(=O)[nH]c(=O)n5CCCCCCCC)cc4)cc3C(=O)OCC)cc2)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C52H60N6O8/c1-5-9-11-13-15-17-31-57-41(33-47(59)55-51(57)63)29-23-37-19-25-39(26-20-37)53-45-35-44(50(62)66-8-4)46(36-43(45)49(61)65-7-3)54-40-27-21-38(22-28-40)24-30-42-34-48(60)56-52(64)58(42)32-18-16-14-12-10-6-2/h19-22,25-28,33-36,53-54H,5-18,31-32H2,1-4H3,(H,55,59,63)(H,56,60,64) |
| InChIKey | ZJJHJARHNGUDCS-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 186.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.09 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|