C19H18O5 — CID 132552295
(1S,12R,15R,16R,21R)-16-hydroxy-15-methyl-8,13,17-trioxahexacyclo[14.2.2.11,12.02,10.05,9.015,21]henicosa-2(10),3,5(9),6-tetraen-14-one (PubChem CID 132552295) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (1S,12R,15R,16R,21R)-16-hydroxy-15-methyl-8,13,17-trioxahexacyclo[14.2.2.11,12.02,10.05,9.015,21]henicosa-2(10),3,5(9),6-tetraen-14-one.
| Compound Name | (1S,12R,15R,16R,21R)-16-hydroxy-15-methyl-8,13,17-trioxahexacyclo[14.2.2.11,12.02,10.05,9.015,21]henicosa-2(10),3,5(9),6-tetraen-14-one |
|---|---|
| PubChem CID | 132552295 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1S,12R,15R,16R,21R)-16-hydroxy-15-methyl-8,13,17-trioxahexacyclo[14.2.2.11,12.02,10.05,9.015,21]henicosa-2(10),3,5(9),6-tetraen-14-one |
| SMILES | C[C@]12C(=O)O[C@@H]3Cc4c(ccc5ccoc45)[C@]4(CC[C@@]1(O)OC4)[C@@H]32 |
| InChI | InChI=1S/C19H18O5/c1-17-15-13(24-16(17)20)8-11-12(3-2-10-4-7-22-14(10)11)18(15)5-6-19(17,21)23-9-18/h2-4,7,13,15,21H,5-6,8-9H2,1H3/t13-,15+,17+,18-,19-/m1/s1 |
| InChIKey | HDJDBLLWQBRQMW-DKEKNDPOSA-N |
| XLogP | 2.29 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |