About tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate
tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate (PubChem CID 132552426) has the molecular formula C15H18BrNO3
and a molecular weight of 340.22 g/mol. Its IUPAC name is tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate |
| PubChem CID | 132552426 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1N=CO[C@@]1(C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H18BrNO3/c1-14(2,3)20-13(18)12-15(4,19-9-17-12)10-5-7-11(16)8-6-10/h5-9,12H,1-4H3/t12-,15-/m0/s1 |
| InChIKey | NYFBLYVVRWKMHG-WFASDCNBSA-N |
| XLogP | 3.43 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate?
The IUPAC name of tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate (CID 132552426) is tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate?
The canonical SMILES for tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate is CC(C)(C)OC(=O)[C@@H]1N=CO[C@@]1(C)c1ccc(Br)cc1.
What is the InChIKey of tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate?
The InChIKey is NYFBLYVVRWKMHG-WFASDCNBSA-N. The full InChI is InChI=1S/C15H18BrNO3/c1-14(2,3)20-13(18)12-15(4,19-9-17-12)10-5-7-11(16)8-6-10/h5-9,12H,1-4H3/t12-,15-/m0/s1.
What are the key properties of tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate?
tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate has a molecular weight of 340.22 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4R,5S)-5-(4-bromophenyl)-5-methyl-4H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 132552426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).