About 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol
4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol (PubChem CID 132552488) has the molecular formula C24H22O
and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol.
Molecular Properties
| Compound Name | 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol |
| PubChem CID | 132552488 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol |
| SMILES | C[C@H](C1=C(c2ccccc2)c2ccccc2CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H22O/c1-17(18-11-14-21(25)15-12-18)22-16-13-19-7-5-6-10-23(19)24(22)20-8-3-2-4-9-20/h2-12,14-15,17,25H,13,16H2,1H3/t17-/m0/s1 |
| InChIKey | VEDPVORAYWZZIW-KRWDZBQOSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol?
The IUPAC name of 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol (CID 132552488) is 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol.
What is the SMILES notation for 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol?
The canonical SMILES for 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol is C[C@H](C1=C(c2ccccc2)c2ccccc2CC1)c1ccc(O)cc1.
What is the InChIKey of 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol?
The InChIKey is VEDPVORAYWZZIW-KRWDZBQOSA-N. The full InChI is InChI=1S/C24H22O/c1-17(18-11-14-21(25)15-12-18)22-16-13-19-7-5-6-10-23(19)24(22)20-8-3-2-4-9-20/h2-12,14-15,17,25H,13,16H2,1H3/t17-/m0/s1.
What are the key properties of 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol?
4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol has a molecular weight of 326.44 g/mol, XLogP of 5.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1-(1-phenyl-3,4-dihydronaphthalen-2-yl)ethyl]phenol is sourced from PubChem (CID 132552488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).