C18H17NO5 — CID 132552527
ethyl (2R,5E)-5-[furan-3-yl(hydroxy)methylidene]-4-oxo-2,3-dihydro-1H-1-benzazepine-2-carboxylate (PubChem CID 132552527) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl (2R,5E)-5-[furan-3-yl(hydroxy)methylidene]-4-oxo-2,3-dihydro-1H-1-benzazepine-2-carboxylate.
| Compound Name | ethyl (2R,5E)-5-[furan-3-yl(hydroxy)methylidene]-4-oxo-2,3-dihydro-1H-1-benzazepine-2-carboxylate |
|---|---|
| PubChem CID | 132552527 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | ethyl (2R,5E)-5-[furan-3-yl(hydroxy)methylidene]-4-oxo-2,3-dihydro-1H-1-benzazepine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)/C(=C(/O)c2ccoc2)c2ccccc2N1 |
| InChI | InChI=1S/C18H17NO5/c1-2-24-18(22)14-9-15(20)16(17(21)11-7-8-23-10-11)12-5-3-4-6-13(12)19-14/h3-8,10,14,19,21H,2,9H2,1H3/b17-16+/t14-/m1/s1 |
| InChIKey | UDSHFCCNYWETCN-UVTIVQHFSA-N |
| XLogP | 3.02 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|