C13H8N2S3 — CID 132552646
2-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)pyridin-4-amine (PubChem CID 132552646) has the molecular formula C13H8N2S3 and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)pyridin-4-amine.
| Compound Name | 2-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 132552646 |
| Molecular Formula | C13H8N2S3 |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)pyridin-4-amine |
| SMILES | Nc1ccnc(-c2cc3sc4ccsc4c3s2)c1 |
| InChI | InChI=1S/C13H8N2S3/c14-7-1-3-15-8(5-7)10-6-11-13(18-10)12-9(17-11)2-4-16-12/h1-6H,(H2,14,15) |
| InChIKey | AEEBUQYGVYFROT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |