C25H28O7 — CID 132552685
(1R,2S)-8-[(2R)-2,3-dihydroxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one (PubChem CID 132552685) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is (1R,2S)-8-[(2R)-2,3-dihydroxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one.
| Compound Name | (1R,2S)-8-[(2R)-2,3-dihydroxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
|---|---|
| PubChem CID | 132552685 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (1R,2S)-8-[(2R)-2,3-dihydroxy-3-methylbutyl]-1,11-dihydroxy-5-methyl-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-12-one |
| SMILES | C=C(C)[C@H]1COc2c(C)cc3oc4c(C[C@@H](O)C(C)(C)O)ccc(O)c4c(=O)c3c2[C@@H]1O |
| InChI | InChI=1S/C25H28O7/c1-11(2)14-10-31-23-12(3)8-16-19(20(23)21(14)28)22(29)18-15(26)7-6-13(24(18)32-16)9-17(27)25(4,5)30/h6-8,14,17,21,26-28,30H,1,9-10H2,2-5H3/t14-,17-,21-/m1/s1 |
| InChIKey | SLCCOTGLZNLRJS-SOIKWTOOSA-N |
| XLogP | 3.25 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|