C10H7ClO6 — CID 13255308
6-chloro-2,2,3,3-tetrahydroxynaphthalene-1,4-dione (PubChem CID 13255308) has the molecular formula C10H7ClO6 and a molecular weight of 258.61 g/mol. Its IUPAC name is 6-chloro-2,2,3,3-tetrahydroxynaphthalene-1,4-dione.
| Compound Name | 6-chloro-2,2,3,3-tetrahydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 13255308 |
| Molecular Formula | C10H7ClO6 |
| Molecular Weight | 258.61 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 6-chloro-2,2,3,3-tetrahydroxynaphthalene-1,4-dione |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C10H7ClO6/c11-4-1-2-5-6(3-4)8(13)10(16,17)9(14,15)7(5)12/h1-3,14-17H |
| InChIKey | NYHSRGLXTUXXSY-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.61 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|